CAS 82804-30-6

1-(4-phenylphenyl)propan-2-ylazanium chloride

Description:

1-(4-phenylphenyl)propan-2-ylazanium chloride, identified by its CAS number 82804-30-6, is a quaternary ammonium compound characterized by its unique structure, which includes a propan-2-yl group attached to a phenyl-substituted azanium moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a solid at room temperature and having good solubility in polar solvents like water and alcohols. Its phenyl groups contribute to its hydrophobic characteristics, potentially influencing its interactions in biological systems and materials science. The presence of the azanium group suggests it may exhibit basicity and can participate in ionic interactions. Additionally, this compound may have applications in various fields, including pharmaceuticals, where its quaternary structure could enhance its efficacy as a drug or as a surfactant in formulations. Safety data should be consulted for handling and potential toxicity, as quaternary ammonium compounds can have varying effects depending on their specific structure and substituents.

Formula: C₁₅H₁₈ClN

InChI: InChI=1S/C15H17N.ClH/c1-12(16)11-13-7-9-15(10-8-13)14-5-3-2-4-6-14;/h2-10,12H,11,16H2,1H3;1H

InChI key: KCFXOYGMMYOKSP-UHFFFAOYSA-N

SMILES: CC(CC1=CC=C(C=C1)C2=CC=CC=C2)[NH3+].[Cl-]

Synonyms:

• dl-p-Fenil-alpha-metilfenetilamina HCl [Italian]
• dl-alpha-Methyl-4-biphenylethylamine hydrochloride
• 4-BIPHENYLETHYLAMINE, alpha-METHYL-, HYDROCHLORIDE, dl-

1-{[1,1'-Biphenyl]-4-yl}propan-2-amine hydrochloride

CAS: 82804-30-6

Versatile small molecule scaffold

Formula: C₁₅H₁₈ClN

Purity: Min. 95%

Molecular weight: 247.76 g/mol

Ref: 3D-HDA80430