CymitQuimica logo

CAS 82832-27-7

:

trans,trans-4-(4-Fluorophenyl)-4'-propylbicyclohexyl

Description:
Trans,trans-4-(4-Fluorophenyl)-4'-propylbicyclohexyl, identified by its CAS number 82832-27-7, is an organic compound characterized by its bicyclic structure, which consists of two fused cyclohexane rings. The presence of a propyl group and a fluorophenyl group contributes to its unique chemical properties and potential applications. This compound is typically non-polar, which influences its solubility in organic solvents rather than in water. The fluorine atom in the phenyl group can enhance the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry and material science. Additionally, the trans configuration of the substituents suggests a specific spatial arrangement that can impact the compound's reactivity and interactions with other molecules. Overall, trans,trans-4-(4-Fluorophenyl)-4'-propylbicyclohexyl is a compound of interest for research in various fields, including pharmaceuticals and organic synthesis.
Formula:C21H31F
InChI:InChI=1/C21H31F/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)20-12-14-21(22)15-13-20/h12-19H,2-11H2,1H3/t16-,17?,18-,19-
InChI key:IKODGORUTZMKPL-UHFFFAOYSA-N
SMILES:CCC[C@H]1CCC(CC1)[C@H]1CC[C@@H](CC1)c1ccc(cc1)F
Found 5 products.