CAS 82855-64-9

4-(dimethylamino)-1-pentofuranosylpyrimidin-2(1H)-one

Description:

4-(Dimethylamino)-1-pentofuranosylpyrimidin-2(1H)-one, with the CAS number 82855-64-9, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidinone core, which is a six-membered aromatic ring containing nitrogen atoms, and is substituted with a dimethylamino group and a pentofuranosyl moiety. The presence of the dimethylamino group suggests that the compound may exhibit basic properties, potentially influencing its solubility and reactivity. The furanosyl component indicates that it has a sugar-like structure, which may play a role in biological activity, particularly in nucleoside analogs. This compound may be of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to its structural similarities to nucleotides. Its specific physical and chemical properties, such as melting point, solubility, and spectral characteristics, would require experimental determination or detailed literature references for precise values.

Formula: C₁₁H₁₇N₃O₅

InChI: InChI=1/C11H17N3O5/c1-13(2)7-3-4-14(11(18)12-7)10-9(17)8(16)6(5-15)19-10/h3-4,6,8-10,15-17H,5H2,1-2H3

InChI key: GFCDNWCHLZESES-UHFFFAOYSA-N

SMILES: CN(C)c1ccn(C2C(C(C(CO)O2)O)O)c(=O)n1

N4,N4-Dimethylarabinocytidine

CAS: 82855-64-9

N4,N4-Dimethylarabinocytidine is a Nucleoside Derivative - Arabino-nucleoside, N-Methylated nucleoside.

Formula: C₁₁H₁₇N₃O₅

Color and Shape: Solid

Molecular weight: 271.27

Ref: TM-TNU0392