CymitQuimica logo

CAS 82954-89-0

:

Ethylboronic acid pinacol ester

Description:
Ethylboronic acid pinacol ester, with the CAS number 82954-89-0, is an organoboron compound characterized by the presence of a boron atom bonded to an ethyl group and a pinacol ester moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. Ethylboronic acid pinacol ester is known for its utility in organic synthesis, particularly in cross-coupling reactions, such as Suzuki-Miyaura coupling, where it serves as a versatile boron reagent. It exhibits moderate stability under standard conditions but can be sensitive to moisture and air, necessitating careful handling and storage. The compound is soluble in organic solvents like dichloromethane and ether, making it suitable for various synthetic applications. Its reactivity is attributed to the boron atom, which can form coordinate bonds with nucleophiles, facilitating the formation of carbon-carbon bonds in synthetic pathways. Overall, ethylboronic acid pinacol ester is a valuable intermediate in the synthesis of complex organic molecules.
Formula:C8H17BO2
InChI:InChI=1S/C8H17BO2/c1-6-9-10-7(2,3)8(4,5)11-9/h6H2,1-5H3
InChI key:NPUBDPDASOEIOA-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)CC
Synonyms:
  • 2-Ethyl-4,4,5,5-Tetramethyl-1,3,2-Dioxaborolane
  • 1,3,2-Dioxaborolane, 2-ethyl-4,4,5,5-tetramethyl-
Found 6 products.