CAS 83-49-8

Hyodeoxycholic acid

Description:

Hyodeoxycholic acid is a bile acid that is classified as a steroid and is derived from cholesterol. It is characterized by its hydrophobic and hydrophilic regions, which contribute to its role in emulsifying fats and aiding in their digestion and absorption in the intestines. This compound has a molecular formula that reflects its steroid structure, typically featuring multiple hydroxyl groups that enhance its solubility in water. Hyodeoxycholic acid is known to exhibit biological activities, including potential effects on lipid metabolism and modulation of gut microbiota. It is also studied for its role in various physiological processes and its potential therapeutic applications. The substance is generally found in the bile of certain animals and can be synthesized in the laboratory. Its CAS number, 83-49-8, is a unique identifier that facilitates its recognition in chemical databases and literature. As with many bile acids, hyodeoxycholic acid may also have implications in the study of liver function and disorders related to bile acid metabolism.

Formula:C₂₄H₄₀O₄

InChI:InChI=1S/C24H40O4/c1-14(4-7-22(27)28)17-5-6-18-16-13-21(26)20-12-15(25)8-10-24(20,3)19(16)9-11-23(17,18)2/h14-21,25-26H,4-13H2,1-3H3,(H,27,28)/t14-,15-,16+,17-,18+,19+,20+,21+,23-,24-/m1/s1

InChI key:InChIKey=DGABKXLVXPYZII-SIBKNCMHSA-N

SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H](CCC(O)=O)C)(CC4)[H])[H])(C[C@H](O)[C@@]1(C[C@H](O)CC2)[H])[H])[H]

Synonyms:

(3Alpha,5Beta,6Alpha)-3,6-Dihydroxycholan-24-Oate
(3Alpha,5Beta,6Alpha)-3,6-Dihydroxycholan-24-Oic Acid
(3Alpha,5Beta,6Alpha,8Xi,9Xi,14Xi)-3,6-Dihydroxycholan-24-Oic Acid
(3Alpha,6Alpha)-3,6-Dihydroxycholan-24-Oic Acid
(3α,5β,6α)-3,6-Dihydroxycholan-24-oic acid
3,6-Dihydroxycholan-24-Oic Acid
3alpha,6alpha-Dihydroxy-5beta-cholan-24-oic acid
3α,6α-Dihydroxy-5β-cholan-24-oate
3α,6α-Dihydroxy-5β-cholan-24-oic acid
3α,6α-Dihydroxy-5β-cholanic acid
3α,6α-Dihydroxy-5β-cholanoic acid
4-[(3R,5R,6S,10R,13R,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
5β-Cholan-24-oic acid, 3α,6α-dihydroxy-
5β-Cholanic acid, 3α,6α-dihydroxy-
6α-Hydroxylithocholic acid
7-Deoxyhyocholic acid
Cholan-24-oic acid, 3,6-dihydroxy-, (3α,5β,6α)-
Hyodesoxycholic acid
Iodeoxycholic acid
NSC 60672
Pig Hyodeoxycholic acid
See more synonyms