CymitQuimica logo

CAS 83054-80-2

:

N,N'-bis(2,5-di-T-bu-phenyl)-3,4,9,10-perylenedic

Description:
N,N'-bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylenedicarboximide, commonly referred to by its CAS number 83054-80-2, is a synthetic organic compound characterized by its robust structure and significant photophysical properties. This compound features a perylene core, which is known for its high stability and strong fluorescence, making it valuable in applications such as organic semiconductors and dyes. The presence of two bulky tert-butyl groups on the phenyl substituents enhances its solubility in organic solvents and contributes to its thermal stability. Additionally, the imide functional groups in the structure provide potential for further chemical modifications. The compound exhibits strong absorption in the visible region and can emit light upon excitation, making it useful in optoelectronic devices. Its unique properties also make it a candidate for use in organic photovoltaics and as a fluorescent probe in various chemical and biological applications. Overall, this compound exemplifies the intersection of organic chemistry and materials science, showcasing the importance of molecular design in developing advanced materials.
Formula:C52H50N2O4
InChI:InChI=1/C52H50N2O4/c1-49(2,3)27-13-23-37(51(7,8)9)39(25-27)53-45(55)33-19-15-29-31-17-21-35-44-36(22-18-32(42(31)44)30-16-20-34(46(53)56)43(33)41(29)30)48(58)54(47(35)57)40-26-28(50(4,5)6)14-24-38(40)52(10,11)12/h13-26H,1-12H3
InChI key:BIYPCKKQAHLMHG-UHFFFAOYSA-N
SMILES:CC(C)(C)c1ccc(c(c1)n1c(=O)c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)c1=O)c46)c(=O)n(c1cc(ccc1C(C)(C)C)C(C)(C)C)c5=O)C(C)(C)C
Synonyms:
  • N,N-bis(2,5-di-T-butylphenyl)-3,4*9,10-perylened
  • N,N-Bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylenedicarboximide
  • 2,9-bis(2,5-di-tert-butylphenyl)isoquino[4',5',6':6,5,10]anthra[2,1,9-def]isoquinoline-1,3,8,10(2H,9H)-tetrone
  • N,N'-bis(2,5-di-tert-butylphenyl)-3,4,9,10-perylene dicarboximide
  • Lt-S902
  • Pdcdt
Found 3 products.