CymitQuimica logo

CAS 831243-31-3

:

Acetamide, 2-[2-(1,1-dimethylethyl)phenoxy]-N-(4-hydroxyphenyl)-

Description:
Acetamide, 2-[2-(1,1-dimethylethyl)phenoxy]-N-(4-hydroxyphenyl)-, identified by CAS number 831243-31-3, is an organic compound characterized by its amide functional group, which is linked to a phenolic structure. This compound features a bulky tert-butyl group, contributing to its hydrophobic characteristics, and a hydroxyphenyl moiety that may enhance its solubility in polar solvents. The presence of the acetamide group suggests potential applications in pharmaceuticals or agrochemicals, as amides often exhibit favorable biological activity. Its molecular structure indicates that it may participate in hydrogen bonding due to the hydroxyl group, influencing its reactivity and interactions with other molecules. Additionally, the compound's unique substituents may impart specific properties such as increased stability or altered lipophilicity, making it of interest in various chemical and biological contexts. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in medicinal chemistry and material science.
Formula:C18H21NO3
InChI:InChI=1S/C18H21NO3/c1-18(2,3)15-6-4-5-7-16(15)22-12-17(21)19-13-8-10-14(20)11-9-13/h4-11,20H,12H2,1-3H3,(H,19,21)
InChI key:RUNXUUCDTNJFME-UHFFFAOYSA-N
SMILES:CC(C)(C)C1=CC=CC=C1OCC(=O)NC2=CC=C(C=C2)O
Synonyms:
  • Acetamide, 2-[2-(1,1-dimethylethyl)phenoxy]-N-(4-hydroxyphenyl)-
Found 4 products.