CAS 83156-04-1

Formula: C20H24O7

InChI: InChI=1S/C20H24O7/c1-6-11(2)19(23)27-18(20(3,4)24)17(22)13-9-12-7-8-16(21)26-14(12)10-15(13)25-5/h6-10,17-18,22,24H,1-5H3/b11-6+/t17-,18+/m1/s1

InChI key: GFMYIOGFYYHKLA-ZRKIHGRPSA-N

SMILES: C/C=C(\C)/C(=O)O[C@@H]([C@@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)C(C)(C)O

Angelol B

CAS: 83156-04-1

Angelol B

Molecular weight: 376.15

Ref: 10-F565186

AngelolB

CAS: 83156-04-1

AngelolB

Formula: C₂₀H₂₄O₇

Purity: ≥98%

Molecular weight: 376.4

Ref: 54-OR1127102

Angelol B

CAS: 83156-04-1

Formula: C₂₀H₂₄O₇

Molecular weight: 376.41

Ref: 7W-GY5196

Angelol B

CAS: 83156-04-1

Formula: C₂₀H₂₄O₇

Purity: 95%~99%

Molecular weight: 376.405

Ref: BP-BP3751

AngelolB

CAS: 83156-04-1

Formula: C₂₀H₂₄O₇

Purity: 98%

Molecular weight: 376.4004

Ref: IN-DA01DDDP

Angelol B

CAS: 83156-04-1

The absorption and transport of angelol A and Angelol B are passive diffusion as the dominating process in Caco-2 cell monolayer model.

Formula: C₂₀H₂₄O₇

Purity: 98%

Color and Shape: Solid

Molecular weight: 376.4004

Ref: TM-TN1387

Angelol B

CAS: 83156-04-1

Angelol B is a phytochemical compound, which is a bioactive product derived from natural sources such as plants in the Angelica genus. It operates through a mode of action that involves the disruption of microbial cell walls, leading to cell lysis and subsequent inhibition of microbial growth. Angelol B's multifaceted mechanism makes it an effective antimicrobial agent against a broad spectrum of pathogens.

Formula: C₂₀H₂₄O₇

Purity: Min. 95%

Molecular weight: 376.4 g/mol

Ref: 3D-IDA15604