CymitQuimica logo

CAS 832076-92-3

:

Oxazole, 4-(chloromethyl)-2-(4-chlorophenyl)-5-methyl-

Description:
Oxazole, 4-(chloromethyl)-2-(4-chlorophenyl)-5-methyl- is a heterocyclic organic compound characterized by the presence of an oxazole ring, which consists of a five-membered ring containing both nitrogen and oxygen atoms. This specific compound features a chloromethyl group and a 4-chlorophenyl substituent, contributing to its unique chemical properties and potential reactivity. The methyl group at the 5-position of the oxazole ring further influences its electronic characteristics and steric hindrance. Generally, compounds like this can exhibit biological activity, making them of interest in medicinal chemistry and drug development. The presence of chlorine atoms can enhance lipophilicity and alter the compound's interaction with biological targets. Additionally, the structural features may affect solubility, stability, and reactivity, which are crucial for applications in pharmaceuticals or agrochemicals. As with many heterocycles, the synthesis and characterization of such compounds are essential for understanding their potential uses and mechanisms of action in various chemical contexts.
Formula:C11H9Cl2NO
InChI:InChI=1S/C11H9Cl2NO/c1-7-10(6-12)14-11(15-7)8-2-4-9(13)5-3-8/h2-5H,6H2,1H3
InChI key:UZZOBOWGDDNXRM-UHFFFAOYSA-N
SMILES:CC1=C(N=C(O1)C2=CC=C(C=C2)Cl)CCl
Found 2 products.