CAS 83209-65-8

(3S,6R,9R,14aR)-3,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]decahydropyrrolo[1,2-a][1,4,7,10]tetraazacyclododecine-1,4,7,10-tetrone

Description:

The chemical substance with the name "(3S,6R,9R,14aR)-3,6-dimethyl-9-[6-(oxiran-2-yl)-6-oxohexyl]decahydropyrrolo[1,2-a][1,4,7,10]tetraazacyclododecine-1,4,7,10-tetrone" and CAS number "83209-65-8" is a complex organic compound characterized by its multi-cyclic structure and multiple functional groups. It features a decahydropyrrolo framework, which is indicative of its potential biological activity, possibly as a pharmaceutical agent. The presence of oxirane (epoxide) and keto groups suggests reactivity that could be exploited in synthetic applications or biological interactions. The stereochemistry, denoted by the specific configuration at several chiral centers, implies that the compound may exhibit specific interactions with biological targets, which is crucial for its potential efficacy in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity would depend on its molecular structure and the presence of functional groups, making it a candidate for further study in drug development or chemical synthesis.

Formula: C₂₁H₃₂N₄O₆

InChI: InChI=1/C21H32N4O6/c1-12-18(27)22-13(2)19(28)24-14(7-4-3-5-9-16(26)17-11-31-17)21(30)25-10-6-8-15(25)20(29)23-12/h12-15,17H,3-11H2,1-2H3,(H,22,27)(H,23,29)(H,24,28)/t12-,13+,14+,15+,17?/m0/s1

InChI key: GNYCTMYOHGBSBI-SVZOTFJBSA-N

SMILES: C[C@@H]1C(=O)N[C@H](C(=O)N2CCC[C@@H]2C(=O)N[C@H](C(=O)N1)C)CCCCCC(=O)[C@@H]3CO3

HC-Toxin

CAS: 83209-65-8

HC-Toxin

Molecular weight: 436.23

Ref: 10-F557436

HC toxin

CAS: 83209-65-8

HC toxin

Formula: C₂₁H₃₂N₄O₆

Molecular weight: 436.50198

Ref: 54-BI12139

HC Toxin

CAS: 83209-65-8

HC Toxin: cyclic tetrapeptide, reversible HDAC inhibitor (IC50=30 nM), upregulates 15-lipoxygenase-1, induces fetal hemoglobin, from C. carbonum.

Formula: C₂₁H₃₂N₄O₆

Color and Shape: Solid

Molecular weight: 436.502

Ref: TM-T35774