CymitQuimica logo

CAS 832114-05-3

:

tert-butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamate

Description:
Tert-butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamate is an organic compound characterized by its complex structure, which includes a tert-butyl group, a benzyl moiety, and a carbamate functional group. The presence of the dioxaborolane ring contributes to its reactivity, particularly in organoboron chemistry, making it useful in various synthetic applications, including cross-coupling reactions. This compound is typically a solid at room temperature and is soluble in organic solvents such as dichloromethane and ethyl acetate. Its stability can be influenced by environmental factors such as moisture and temperature, given the presence of the boron atom, which can undergo hydrolysis. The compound's unique structure allows it to participate in diverse chemical reactions, making it valuable in medicinal chemistry and materials science. Safety precautions should be taken when handling this compound, as with many organoboron compounds, due to potential toxicity and reactivity.
Formula:C18H28BNO4
InChI:InChI=1/C18H28BNO4/c1-16(2,3)22-15(21)20-12-13-9-8-10-14(11-13)19-23-17(4,5)18(6,7)24-19/h8-11H,12H2,1-7H3,(H,20,21)
InChI key:ANBFXKONRFZJAO-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCc1cccc(c1)B1OC(C)(C)C(C)(C)O1)O
Synonyms:
  • Carbamic acid, N-[[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-, 1,1-dimethylethyl ester
  • tert-Butyl [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl]carbamate
Found 5 products.