CAS 83242-95-9
:Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide
Description:
Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide, with CAS number 83242-95-9, is a chemical compound that belongs to the class of phosphine oxides. It is characterized by its complex structure, which includes an octyl group, a phenyl group, and two isobutyl groups attached to a carbamoyl moiety. This compound is typically used in various applications, including as a ligand in coordination chemistry and in the extraction of metal ions. Its phosphine oxide functionality contributes to its ability to form stable complexes with transition metals. The presence of both hydrophobic (octyl and isobutyl groups) and hydrophilic (carbamoyl and phosphine oxide) components allows for versatile interactions in different chemical environments. Additionally, the compound may exhibit properties such as thermal stability and solubility in organic solvents, making it suitable for use in various industrial and research applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C24H40NO2P
InChI:InChI=1/C24H40NO2P/c1-6-7-8-9-10-14-17-24(28-27,22-15-12-11-13-16-22)23(26)25(18-20(2)3)19-21(4)5/h11-13,15-16,20-21H,6-10,14,17-19H2,1-5H3
SMILES:CCCCCCCCC(c1ccccc1)(C(=O)N(CC(C)C)CC(C)C)P=O
Synonyms:- Acetamide, N,N-bis(2-methylpropyl)-2-(octylphenylphosphinyl)-
- N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide
- N,N-bis(2-methylpropyl)-2-(oxophosphanyl)-2-phenyldecanamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N,N-Diisobutyl-2-(octyl(phenyl)phosphoryl)acetamide
CAS:Formula:C24H42NO2PPurity:95%Color and Shape:SolidMolecular weight:407.5695N,N-Diisobutyl-2-(octyl-phenyl-phosphinoyl)-acetamide
CAS:N,N-Diisobutyl-2-(octyl-phenyl-phosphinoyl)-acetamidePurity:98%Molecular weight:407.57g/molN,N-Diisobutyl-2-[octyl(phenyl)phosphoryl]acetamide
CAS:Formula:C24H42NO2PPurity:>98.0%(HPLC)(qNMR)Color and Shape:White to Light yellow powder to crystalMolecular weight:407.58N,N-Diisobutyl-2-(octylphenylphosphoryl)acetamide
CAS:N,N-Diisobutyl-2-(octylphenylphosphoryl)acetamide is a redox active extractant that is used for the extraction of metals from acidic solutions. It has been shown to have an adsorption mechanism that includes hydrogen bonding and intramolecular hydrogen bonding. N,N-Diisobutyl-2-(octylphenylphosphoryl)acetamide also has a high redox potential and fluorescence properties. This extractant can be used as a metal chelate to extract copper from hydroxide or carbonate solutions. It can also be used in titration calorimetry experiments.Formula:C24H42NO2PPurity:Min. 98 Area-%Color and Shape:White To Off-White SolidMolecular weight:407.57 g/mol




