CymitQuimica logo

CAS 83242-95-9

:

Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide

Description:
Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide, with CAS number 83242-95-9, is a chemical compound that belongs to the class of phosphine oxides. It is characterized by its complex structure, which includes an octyl group, a phenyl group, and two isobutyl groups attached to a carbamoyl moiety. This compound is typically used in various applications, including as a ligand in coordination chemistry and in the extraction of metal ions. Its phosphine oxide functionality contributes to its ability to form stable complexes with transition metals. The presence of both hydrophobic (octyl and isobutyl groups) and hydrophilic (carbamoyl and phosphine oxide) components allows for versatile interactions in different chemical environments. Additionally, the compound may exhibit properties such as thermal stability and solubility in organic solvents, making it suitable for use in various industrial and research applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C24H40NO2P
InChI:InChI=1/C24H40NO2P/c1-6-7-8-9-10-14-17-24(28-27,22-15-12-11-13-16-22)23(26)25(18-20(2)3)19-21(4)5/h11-13,15-16,20-21H,6-10,14,17-19H2,1-5H3
InChI key:SGZRFMMIONYDQU-UHFFFAOYSA-N
SMILES:CCCCCCCCC(c1ccccc1)(C(=O)N(CC(C)C)CC(C)C)P=O
Synonyms:
  • Acetamide, N,N-bis(2-methylpropyl)-2-(octylphenylphosphinyl)-
  • N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide
  • N,N-bis(2-methylpropyl)-2-(oxophosphanyl)-2-phenyldecanamide
Found 6 products.