CAS 83265-56-9
:2-amino-5-(trifluoromethoxy)benzoic acid
Description:
2-Amino-5-(trifluoromethoxy)benzoic acid, with the CAS number 83265-56-9, is an aromatic compound characterized by the presence of an amino group and a trifluoromethoxy substituent on a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The amino group can participate in hydrogen bonding, making the compound potentially soluble in polar solvents. Its structural features suggest that it may exhibit interesting pharmacological properties, possibly acting as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of fluorine atoms typically imparts unique electronic properties, which can affect the compound's interaction with biological targets. Overall, 2-amino-5-(trifluoromethoxy)benzoic acid is a compound of interest in both synthetic chemistry and medicinal chemistry due to its unique functional groups and potential applications.
Formula:C8H6F3NO3
InChI:InChI=1/C8H6F3NO3/c9-8(10,11)15-4-1-2-6(12)5(3-4)7(13)14/h1-3H,12H2,(H,13,14)
SMILES:c1cc(c(cc1OC(F)(F)F)C(=O)O)N
Synonyms:- 5-(Trifluoromethoxy)anthranilic acid
- Benzoic acid, 2-amino-5-(trifluoromethoxy)-
- QVR BZ EOXFFF2-Amino-5-Trifluoromethoxybenzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-(trifluoromethoxy)benzoic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H6F3NO3Purity:98%Color and Shape:White to cream or pale yellow, Crystals or powder or crystalline powderMolecular weight:221.142-Amino-5-(trifluoromethoxy)benzoic acid
CAS:Formula:C8H6F3NO3Purity:95%Color and Shape:SolidMolecular weight:221.13332-Amino-5-(trifluoromethoxy)benzoic acid
CAS:2-Amino-5-(trifluoromethoxy)benzoic acidFormula:C8H6F3NO3Purity:97%Color and Shape: off-white solidMolecular weight:221.13g/mol2-Amino-5-trifluoromethoxy-benzoic acid
CAS:Formula:C8H6F3NO3Purity:95%Color and Shape:SolidMolecular weight:221.1352-Amino-5-(trifluoromethoxy)benzoic acid
CAS:Please enquire for more information about 2-Amino-5-(trifluoromethoxy)benzoic acid including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C8H6F3NO3Purity:Min. 95%Molecular weight:221.13 g/mol




