CymitQuimica logo

CAS 83265-56-9

:

2-amino-5-(trifluoromethoxy)benzoic acid

Description:
2-Amino-5-(trifluoromethoxy)benzoic acid, with the CAS number 83265-56-9, is an aromatic compound characterized by the presence of an amino group and a trifluoromethoxy substituent on a benzoic acid framework. This compound features a carboxylic acid functional group, which contributes to its acidic properties. The trifluoromethoxy group enhances the compound's lipophilicity and can influence its reactivity and biological activity. The amino group can participate in hydrogen bonding, making the compound potentially soluble in polar solvents. Its structural features suggest that it may exhibit interesting pharmacological properties, possibly acting as an intermediate in the synthesis of pharmaceuticals or agrochemicals. The presence of fluorine atoms typically imparts unique electronic properties, which can affect the compound's interaction with biological targets. Overall, 2-amino-5-(trifluoromethoxy)benzoic acid is a compound of interest in both synthetic chemistry and medicinal chemistry due to its unique functional groups and potential applications.
Formula:C8H6F3NO3
InChI:InChI=1/C8H6F3NO3/c9-8(10,11)15-4-1-2-6(12)5(3-4)7(13)14/h1-3H,12H2,(H,13,14)
InChI key:UXNGDCBPIGOZFO-UHFFFAOYSA-N
SMILES:c1cc(c(cc1OC(F)(F)F)C(=O)O)N
Synonyms:
  • 5-(Trifluoromethoxy)anthranilic acid
  • Benzoic acid, 2-amino-5-(trifluoromethoxy)-
  • QVR BZ EOXFFF2-Amino-5-Trifluoromethoxybenzoic Acid
Found 6 products.