CymitQuimica logo

CAS 832714-46-2

:

1-Piperidinecarboxylic acid,4-[[1-[2-fluoro-4-(methylsulfonyl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]-, 1-methylethyl ester

Description:
1-Piperidinecarboxylic acid, 4-[[1-[2-fluoro-4-(methylsulfonyl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-4-yl]oxy]-, 1-methylethyl ester, identified by CAS number 832714-46-2, is a complex organic compound characterized by its piperidine and pyrazolopyrimidine moieties. This substance typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural features, which may interact with biological targets. The presence of a fluorine atom and a methylsulfonyl group suggests that it may possess unique electronic properties, influencing its reactivity and interaction with other molecules. The ester functional group indicates that it may undergo hydrolysis under certain conditions, releasing the corresponding acid. This compound is likely of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential therapeutic applications. As with many complex organic compounds, its stability, reactivity, and biological activity would depend on specific environmental conditions and the presence of other chemical entities.
Formula:C21H24FN5O5S
InChI:InChI=1S/C21H24FN5O5S/c1-13(2)31-21(28)26-8-6-14(7-9-26)32-20-16-11-25-27(19(16)23-12-24-20)18-5-4-15(10-17(18)22)33(3,29)30/h4-5,10-14H,6-9H2,1-3H3
InChI key:XTRUQJBVQBUKSQ-UHFFFAOYSA-N
SMILES:CC(C)OC(=O)N1CCC(CC1)OC2=NC=NC3=C2C=NN3C4=C(C=C(C=C4)S(=O)(=O)C)F
Synonyms:
  • Apd668
Found 5 products.