CAS 833-96-5
:3-Sulfurpentafluorobenzoic acid
Description:
3-Sulfurpentafluorobenzoic acid, with the CAS number 833-96-5, is a fluorinated aromatic carboxylic acid characterized by the presence of a benzoic acid structure substituted with five fluorine atoms and a sulfur atom. This compound typically exhibits high thermal stability and is known for its strong acidity due to the carboxylic acid functional group. The presence of multiple electronegative fluorine atoms significantly influences its chemical behavior, enhancing its reactivity and making it a potent electrophile. The sulfur atom in the structure can also contribute to unique chemical properties, potentially allowing for various reactions such as nucleophilic substitutions. 3-Sulfurpentafluorobenzoic acid is often utilized in organic synthesis and materials science, particularly in the development of fluorinated compounds and polymers. Its high electronegativity and unique structural features make it a valuable compound in research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C7H5F5O2S
InChI:InChI=1S/C7H5F5O2S/c8-15(9,10,11,12)6-3-1-2-5(4-6)7(13)14/h1-4H,(H,13,14)
InChI key:AKFDIYXSRGLRAB-UHFFFAOYSA-N
SMILES:C1=CC(=CC(=C1)S(F)(F)(F)(F)F)C(=O)O
Synonyms:- 3-Carboxyphenylsulphur pentafluoride
- 1-Carboxy-phenyl-schwefelpentafluorid-(3)
- 3-Pentafluorsulfanyl-Benzoic Acid
- 3-(Pentafluorosulfanyl)Benzoic Acid
- Pc0800
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(Pentafluorothio)benzoic acid
CAS:3-(Pentafluorothio)benzoic acidFormula:C7H5F5O2SPurity:95%Color and Shape:Off-white SolidMolecular weight:248.1723-(Pentafluorothio)benzoic acid
CAS:3-(Pentafluorothio)benzoic acidFormula:C7H5F5O2SPurity:95%Molecular weight:248.173-(Pentafluorosulfanyl)benzoic acid
CAS:3-(Pentafluorosulfanyl)benzoic acid (3PFSA) is a quinoline derivative used as an agrochemical. It is a research chemical that has not been tested for neurotoxicity, but it is suspected to be neurotoxic due to its structural similarity to other neurotoxic substances. 3PFSA has the potential to be an analog of the synthetic drug pentafluorobenzoic acid (5FBBA). The structure of 3PFSA includes a trifluoromethyl group, which is a functional group that can make compounds more permeable in the brain and could contribute to neurotoxicity.Formula:C7H5F5O2SPurity:Min. 95%Molecular weight:248.17 g/mol3-(Pentafluorosulfanyl)benzoic acid
CAS:Formula:C7H5F5O2SPurity:98%Color and Shape:SolidMolecular weight:248.17




