CymitQuimica logo

CAS 83304-60-3

:

N-benzyl(2,4-dimethoxyphenyl)methanaminium

Description:
N-benzyl(2,4-dimethoxyphenyl)methanaminium, with the CAS number 83304-60-3, is a quaternary ammonium compound characterized by its structure, which includes a benzyl group and a methanaminium moiety attached to a 2,4-dimethoxyphenyl group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can impart antimicrobial and antifungal activities. It is likely to be soluble in polar solvents due to the presence of the charged ammonium group, while the aromatic and methoxy substituents may enhance its lipophilicity. The presence of methoxy groups can also influence its reactivity and interaction with biological systems. Additionally, compounds of this nature are often studied for their potential applications in pharmaceuticals, as well as in various industrial processes, including as disinfectants or preservatives. Safety and handling precautions are essential due to the potential toxicity associated with quaternary ammonium compounds.
Formula:C16H20NO2
InChI:InChI=1/C16H19NO2/c1-18-15-9-8-14(16(10-15)19-2)12-17-11-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3/p+1
InChI key:NUNNRGRUURRZRA-UHFFFAOYSA-N
SMILES:COC1=CC(=C(C=C1)CNCC2=CC=CC=C2)OC
Found 3 products.