CAS 83348-22-5
:methyl (1R,4aR,5R,7aR)-7-({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}methyl)-1-(beta-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
Description:
The chemical substance known as methyl (1R,4aR,5R,7aR)-7-({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}methyl)-1-(beta-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate, with the CAS number 83348-22-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, hydroxyls, and glycosides. This compound features a cyclopentane ring fused with a pyran structure, contributing to its unique stereochemistry and potential biological activity. The presence of a glucopyranosyl moiety suggests that it may exhibit properties related to carbohydrate interactions, while the dihydroxyphenyl group indicates potential antioxidant activity. Its structural complexity may also influence its solubility, stability, and reactivity in various chemical environments. Such compounds are often of interest in medicinal chemistry and natural product research due to their potential therapeutic applications. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C26H30O14
InChI:InChI=1/C26H30O14/c1-36-24(35)13-10-38-25(40-26-23(34)22(33)21(32)17(8-27)39-26)19-12(7-16(30)20(13)19)9-37-18(31)5-3-11-2-4-14(28)15(29)6-11/h2-7,10,16-17,19-23,25-30,32-34H,8-9H2,1H3/b5-3+/t16-,17-,19+,20-,21-,22+,23-,25-,26+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
10-O-Caffeoyl-6-epiferetoside
CAS:<p>10-O-Caffeoyl-6-epiferetoside is a natural product for research related to life sciences. The catalog number is TN2572 and the CAS number is 83348-22-5.</p>Formula:C26H30O14Purity:98%Color and Shape:SolidMolecular weight:566.5110-O-Caffeoyl-6-epiferetoside
CAS:Formula:C26H30O14Purity:95%~99%Color and Shape:PowderMolecular weight:566.51210-Caffeoyldeacetyldaphylloside
CAS:<p>10-Caffeoyldeacetyldaphylloside is a natural compound, which is a type of phenolic glycoside. It is extracted from specific botanical sources, particularly found in certain plant species known for their traditional medicinal uses. This compound exhibits significant antioxidant activity, which is a result of its ability to scavenge free radicals and reduce oxidative stress within biological systems.</p>Formula:C26H30O14Purity:Min. 95%Molecular weight:566.5 g/mol




