CymitQuimica logo

CAS 83348-22-5

:

methyl (1R,4aR,5R,7aR)-7-({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}methyl)-1-(beta-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate

Description:
The chemical substance known as methyl (1R,4aR,5R,7aR)-7-({[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}methyl)-1-(beta-D-glucopyranosyloxy)-5-hydroxy-1,4a,5,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate, with the CAS number 83348-22-5, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as esters, hydroxyls, and glycosides. This compound features a cyclopentane ring fused with a pyran structure, contributing to its unique stereochemistry and potential biological activity. The presence of a glucopyranosyl moiety suggests that it may exhibit properties related to carbohydrate interactions, while the dihydroxyphenyl group indicates potential antioxidant activity. Its structural complexity may also influence its solubility, stability, and reactivity in various chemical environments. Such compounds are often of interest in medicinal chemistry and natural product research due to their potential therapeutic applications. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C26H30O14
InChI:InChI=1/C26H30O14/c1-36-24(35)13-10-38-25(40-26-23(34)22(33)21(32)17(8-27)39-26)19-12(7-16(30)20(13)19)9-37-18(31)5-3-11-2-4-14(28)15(29)6-11/h2-7,10,16-17,19-23,25-30,32-34H,8-9H2,1H3/b5-3+/t16-,17-,19+,20-,21-,22+,23-,25-,26+/m1/s1
InChI key:LLNDGETZUXLFQJ-GEIFZCKHSA-N
SMILES:COC(=O)C1=CO[C@@H]([C@@H]2[C@H]1[C@@H](C=C2COC(=O)/C=C/C3=CC(=C(C=C3)O)O)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O
Found 4 products.