CymitQuimica logo

CAS 83395-39-5

:

1H-Imidazole-1-carboxylicacid,2-propenylester(9CI)

Description:
1H-Imidazole-1-carboxylic acid, 2-propenyl ester (9CI), with the CAS number 83395-39-5, is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylic acid functional group and an ester linkage, specifically with a propenyl group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the imidazole moiety suggests that it may exhibit biological activity, as imidazole derivatives are often found in pharmaceuticals and agrochemicals. The compound is likely to be soluble in organic solvents and may have moderate stability under standard conditions. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the molecular interactions and the environment in which it is used. Overall, 1H-Imidazole-1-carboxylic acid, 2-propenyl ester (9CI) is of interest in synthetic chemistry and may serve as a precursor or intermediate in the synthesis of more complex molecules.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c1-6(2)11-7(10)9-4-3-8-5-9/h3-5H,1H2,2H3
InChI key:NXPBLWUIFYUYRO-UHFFFAOYSA-N
SMILES:CC(=C)OC(=O)N1C=CN=C1
Synonyms:
  • Imidazole-1-carboxylic acid 2-propen-1-yl ester
  • Allyl imidazolecarbamate
  • Allyl 1H-imidazole-1-carboxylate
Found 4 products.