CAS 83411-71-6
:Diisooctylphosphinic acid
Description:
Diisooctylphosphinic acid, with the CAS number 83411-71-6, is an organophosphorus compound characterized by its phosphinic acid functional group. It typically appears as a colorless to pale yellow liquid and is known for its hydrophobic properties, making it soluble in organic solvents while being insoluble in water. This compound is primarily used as a chemical additive, particularly in the formulation of plasticizers and as a stabilizer in various polymer systems. Its structure features two octyl groups attached to the phosphorus atom, which contributes to its low volatility and thermal stability. Diisooctylphosphinic acid exhibits moderate toxicity and should be handled with care, following appropriate safety guidelines. Additionally, it can act as a ligand in coordination chemistry, forming complexes with metal ions, which enhances its utility in various industrial applications. Overall, its unique properties make it valuable in both chemical synthesis and material science.
Formula:C16H35O2P1
InChI:InChI=1/C9H16N2/c1-2-3-4-5-7-11-8-6-10-9-11/h6,8-9H,2-5,7H2,1H3
InChI key:InChIKey=QUXFOKCUIZCKGS-UHFFFAOYSA-N
SMILES:C(P(CC(CC(C)(C)C)C)(=O)O)C(CC(C)(C)C)C
Synonyms:- 1-hexyl-1H-imidazole
- Bis(2,4,4-Trimethylpentyl)-Phosphinicacid
- Bis-(2,4,4-trimethylpentyl)-phosphinic Acid
- Cyanex 272
- Cymanex 272
- Hbtmpp
- Ionquest 290
- P,P-Bis(2,4,4-trimethylpentyl)phosphinic acid
- Phosphinic acid, P,P-bis(2,4,4-trimethylpentyl)-
- Phosphinic acid, bis(2,4,4-trimethylpentyl)-
- Bis(2,4,4-trimethylpentyl)phosphinsure
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Ref: BD-BD256924
100gTo inquireBis(2,4,4-trimethylpentyl)phosphinic Acid
CAS:Formula:C16H35O2PPurity:>95.0%(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:290.43Bis(2,4,4-trimethylpentyl)phosphinic acid, min. 85%, CYTOP® 501
CAS:Formula:C16H35O2PPurity:min. 85%Color and Shape:Yellow liq.Molecular weight:290.42Bis(2,4,4-Trimethylpentyl)phosphinic acid
CAS:Formula:C16H35O2PPurity:90%Color and Shape:LiquidMolecular weight:290.4217Bis(2,4,4-Trimethylpentyl)-Phosphinic Acid
CAS:Bis(2,4,4-Trimethylpentyl)-Phosphinic AcidPurity:90%Molecular weight:290.42g/molBis(2,4,4-trimethylpentyl)phosphinic acid
CAS:Bis(2,4,4-trimethylpentyl)phosphinic acid
Purity:90%Molecular weight:290.42g/molRef: 54-OR80127
2.5lTo inquire5gTo inquire5mlTo inquire10gTo inquire10lTo inquire25gTo inquire25mlTo inquire100gTo inquire100mlTo inquire500gTo inquire500mlTo inquireBis(2,4,4-trimethylpentyl)phosphinic acid
CAS:Formula:C16H35O2PPurity:90.0%Color and Shape:Liquid, ViscousMolecular weight:290.428Bis(2,4,4-trimethylpentyl)phosphinic Acid
CAS:Controlled ProductApplications Bis(2,4,4-trimethylpentyl)phosphinic acid (cas# 83411-71-6) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C16H35O2PColor and Shape:NeatMolecular weight:290.42Bis(2,4,4-trimethylpentyl)phosphinic acid
CAS:Bis(2,4,4-trimethylpentyl)phosphinic acid (diisooctylphosphinic acid) is a slightly water soluble compound which has a variety of applications based upon its metal ion chelating properties. Fe(III) and In(III) ions, for example, can be ligated by phosphinic acids allowing them to transfer from an aqueous into an organic phase, treatment of the organic soluble metal complexes with aqueous acid or base as appropriate selectively strips the phosphinic acid ligands and the metal ions re-enter the aqueous phase. Similarly, heavy metal contaminants can be removed from solid materials using diisooctylphosphinic acid as a ligand in super critical fluid extraction (SFE) processes. Bis(2,4,4-trimethylpentyl)phosphinic acid can also be used as an additive to create halogen-free flame retardant adhesives.Formula:C16H35O2PPurity:Min. 95%Color and Shape:Colorless Clear LiquidMolecular weight:290.42 g/mol







