CymitQuimica logo

CAS 834884-06-9

:

Quinoline, 8-bromo-3-fluoro-

Description:
Quinoline, 8-bromo-3-fluoro- is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of bromine and fluorine substituents at the 8 and 3 positions, respectively, introduces distinct chemical properties and reactivity patterns. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure contributes to its potential applications in pharmaceuticals, agrochemicals, and materials science, particularly in the development of biologically active compounds. The bromine atom can participate in electrophilic substitution reactions, while the fluorine atom may influence the compound's lipophilicity and metabolic stability. Additionally, quinoline derivatives are known for their diverse biological activities, including antimicrobial and antimalarial properties. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks. Overall, Quinoline, 8-bromo-3-fluoro- represents a valuable compound in synthetic organic chemistry and medicinal research.
Formula:C9H5BrFN
InChI:InChI=1S/C9H5BrFN/c10-8-3-1-2-6-4-7(11)5-12-9(6)8/h1-5H
InChI key:QJXZJENSGNZKFV-UHFFFAOYSA-N
SMILES:C1=CC2=CC(=CN=C2C(=C1)Br)F
Found 4 products.