CymitQuimica logo

CAS 834884-22-9

:

4-Quinolinecarboxylic acid, 8-bromo-3-fluoro-

Description:
4-Quinolinecarboxylic acid, 8-bromo-3-fluoro- is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. This compound features a carboxylic acid functional group at the 4-position, a bromine atom at the 8-position, and a fluorine atom at the 3-position of the quinoline ring. The presence of these halogen substituents can influence the compound's reactivity, solubility, and biological activity. Typically, compounds like this may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making them of interest in medicinal chemistry. The molecular structure contributes to its potential applications in pharmaceuticals and agrochemicals. Additionally, the compound's physical properties, such as melting point and solubility, would depend on the specific interactions of the functional groups and the overall molecular geometry. As with many quinoline derivatives, it may also participate in various chemical reactions, including electrophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.
Formula:C10H5BrFNO2
InChI:InChI=1S/C10H5BrFNO2/c11-6-3-1-2-5-8(10(14)15)7(12)4-13-9(5)6/h1-4H,(H,14,15)
InChI key:JEJPYTZZQULSTC-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=CN=C2C(=C1)Br)F)C(=O)O
Synonyms:
  • JEJPYTZZQULSTC-UHFFFAOYSA-N
  • 8-bromo-3-fluoroquinoline-4-carboxylic acid
  • 4-Quinolinecarboxylic acid, 8-bromo-3-fluoro-
Found 2 products.