CAS 83509-42-6
:Homocastasterone
Description:
Homocastasterone is a plant hormone belonging to the brassinosteroid class, which plays a crucial role in various physiological processes in plants, including growth, development, and stress responses. It is characterized by its steroidal structure, which is essential for its biological activity. Homocastasterone is known to promote cell elongation, enhance seed germination, and improve resistance to environmental stresses such as drought and salinity. Its mechanism of action involves binding to specific receptors in plant cells, triggering a cascade of signaling pathways that lead to the expression of target genes associated with growth and stress tolerance. This compound is particularly significant in agricultural research, as it has potential applications in improving crop yield and resilience. Additionally, its presence in various plant species highlights its evolutionary importance in plant biology. Overall, homocastasterone exemplifies the intricate interplay between plant hormones and environmental factors, making it a subject of interest in both basic and applied plant sciences.
Formula:C29H50O5
InChI:InChI=1S/C29H50O5/c1-7-17(15(2)3)27(34)26(33)16(4)19-8-9-20-18-12-23(30)22-13-24(31)25(32)14-29(22,6)21(18)10-11-28(19,20)5/h15-22,24-27,31-34H,7-14H2,1-6H3/t16-,17-,18-,19+,20-,21-,22+,24-,25+,26+,27+,28+,29+/m0/s1
InChI key:InChIKey=WADMTJKRYLAHQV-NKOPCKDMSA-N
SMILES:C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)[C@@]([C@@H]([C@H]([C@@H]([C@H](C(C)C)CC)O)O)C)(CC4)[H])[H])(CC(=O)[C@]1(C[C@H](O)[C@H](O)C2)[H])[H])[H]
Synonyms:- (24S)-24-Ethylbrassinone
- (2α,3α,5α,22R,23R)-2,3,22,23-Tetrahydroxystigmastan-6-one
- 28-Homocastasterone
- Homocastasterone
- Stigmastan-6-one, 2,3,22,23-tetrahydroxy-, (2α,3α,5α,22R,23R)-
- stigmastan-6-one, 2,3,22,23-tetrahydroxy-, (2alpha,3alpha,5alpha,22R,23R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
28-Homo Castasterone
CAS:Controlled ProductFormula:C29H50O5Color and Shape:NeatMolecular weight:478.70428-Homo castasterone
CAS:Controlled Product28-Homo castasterone is a potent, non-selective cation channel blocker that binds to the cytosolic Ca2+ channel. This inhibitor blocks the influx of Ca2+ ions from the extracellular space into cells and has a high resistance to degradation by intracellular esterases. 28-Homo castasterone is used in experimental studies for its cytotoxic effects on cancer cells and its ability to inhibit enzyme activities. The mechanism of action is not known, but it appears to be related to hydrogen bonding interactions. 28-Homo castasterone is found in natural compounds such as gatifloxacin and castasterone.Formula:C29H50O5Purity:Min. 95%Molecular weight:478.7 g/mol

