CymitQuimica logo

CAS 83511-07-3

:

3,7-dihydroxy-2-naphthoic acid

Description:
3,7-Dihydroxy-2-naphthoic acid is an organic compound characterized by its naphthalene structure, which consists of two fused aromatic rings. This compound features two hydroxyl (-OH) groups located at the 3 and 7 positions of the naphthalene ring, contributing to its chemical reactivity and potential applications. It is a derivative of naphthoic acid, which is known for its role in various chemical syntheses and as a building block in organic chemistry. The presence of hydroxyl groups enhances its solubility in polar solvents and can facilitate hydrogen bonding, making it useful in biological and pharmaceutical contexts. Additionally, 3,7-dihydroxy-2-naphthoic acid may exhibit antioxidant properties due to the presence of hydroxyl groups, which can scavenge free radicals. Its CAS number, 83511-07-3, allows for precise identification in chemical databases and literature. Overall, this compound's unique structure and functional groups make it of interest in both research and industrial applications.
Formula:C11H8O4
InChI:InChI=1/C11H8O4/c12-8-2-1-6-5-10(13)9(11(14)15)4-7(6)3-8/h1-5,12-13H,(H,14,15)
InChI key:QMWOUSYSNFCKAZ-UHFFFAOYSA-N
SMILES:c1cc(cc2cc(c(cc12)O)C(=O)O)O
Synonyms:
  • 3,7-Dihydroxy-2-naphtoic acid
  • 2,6-Dihydroxy-3-Naphthoic acid
  • 3,7-Dihydroxynaphthalene-2-Carboxylic Acid
Found 5 products.