CymitQuimica logo

CAS 83515-06-4

:

1H-Indole,5-bromo-2-phenyl-

Description:
1H-Indole,5-bromo-2-phenyl- (CAS 83515-06-4) is a chemical compound that belongs to the indole family, characterized by a bicyclic structure consisting of a benzene ring fused to a pyrrole ring. This compound features a bromine atom at the 5-position and a phenyl group at the 2-position of the indole structure, which can influence its reactivity and biological activity. The presence of the bromine substituent typically enhances the compound's electrophilic character, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the phenyl group can contribute to the compound's lipophilicity, affecting its solubility and interaction with biological systems. 1H-Indole derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The compound's unique structure and substituents may also allow for further functionalization, making it of interest in medicinal chemistry and material science. Overall, 1H-Indole,5-bromo-2-phenyl- is a versatile compound with potential applications in various fields.
Formula:C14H10BrN
InChI:InChI=1S/C14H10BrN/c15-12-6-7-13-11(8-12)9-14(16-13)10-4-2-1-3-5-10/h1-9,16H
InChI key:XGOWHPSXPPZWAH-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC3=C(N2)C=CC(=C3)Br
Synonyms:
  • 5-Bromo-2-phenyl-1H-indole
  • 5-Bromo-2-phenylindole
Found 4 products.