CymitQuimica logo

CAS 83528-03-4

:

5-amino-1-benzofuran-2(3H)-one

Description:
5-Amino-1-benzofuran-2(3H)-one, with the CAS number 83528-03-4, is an organic compound characterized by its benzofuran structure, which consists of a fused benzene and furan ring. The presence of an amino group (-NH2) at the 5-position and a carbonyl group (C=O) at the 2-position contributes to its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, which can facilitate its use in various chemical reactions and applications. It may exhibit properties such as fluorescence, making it of interest in medicinal chemistry and material science. The amino group can participate in hydrogen bonding and nucleophilic reactions, while the carbonyl group can engage in electrophilic reactions. Due to its structural features, 5-amino-1-benzofuran-2(3H)-one may serve as a scaffold for the development of pharmaceuticals or agrochemicals, and its derivatives could possess various biological activities, including antimicrobial or anti-inflammatory properties.
Formula:C8H7NO2
InChI:InChI=1/C8H7NO2/c9-6-1-2-7-5(3-6)4-8(10)11-7/h1-3H,4,9H2
InChI key:XZXLYGAUEAPJET-UHFFFAOYSA-N
SMILES:c1cc2c(cc1N)CC(=O)O2
Found 4 products.