CymitQuimica logo

CAS 83548-46-3

:

1-tert-butyl 2-methyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate

Description:
1-tert-butyl 2-methyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate is an organic compound characterized by its unique pyrrole structure, which features a five-membered ring containing nitrogen. This compound is a derivative of pyrrole, with tert-butyl and methyl groups contributing to its steric and electronic properties. The presence of two carboxylate ester groups enhances its reactivity, making it a potential candidate for various chemical reactions, including esterification and nucleophilic substitution. The tert-butyl group provides significant steric hindrance, which can influence the compound's reactivity and solubility in organic solvents. Additionally, the dihydropyrrole moiety may exhibit interesting biological activities, making it of interest in medicinal chemistry. The compound is typically synthesized through multi-step organic reactions, and its stability and handling require standard precautions typical for organic compounds. Overall, 1-tert-butyl 2-methyl 2,3-dihydro-1H-pyrrole-1,2-dicarboxylate is notable for its structural complexity and potential applications in organic synthesis and pharmaceuticals.
Formula:C11H17NO4
InChI:InChI=1/C11H17NO4/c1-11(2,3)16-10(14)12-7-5-6-8(12)9(13)15-4/h5,7-8H,6H2,1-4H3
InChI key:WGCPPYJWSDCBNC-QMMMGPOBSA-N
SMILES:CC(C)(C)OC(=O)N1C=CCC1C(=O)OC
Found 3 products.