CymitQuimica logo

CAS 835616-39-2

:

1H-Indazol-3-amine, 6-methyl-

Description:
1H-Indazol-3-amine, 6-methyl- (CAS 835616-39-2) is a chemical compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of an amino group (-NH2) at the 3-position and a methyl group (-CH3) at the 6-position of the indazole structure contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often studied for its potential biological activities, including its role in medicinal chemistry as a scaffold for drug development. The compound may also exhibit various reactivity patterns typical of amines and heterocycles, making it of interest in synthetic organic chemistry. Additionally, its molecular structure allows for potential interactions with biological targets, which can be explored in pharmacological studies. Overall, 1H-Indazol-3-amine, 6-methyl- represents a versatile compound with applications in research and development.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-2-3-6-7(4-5)10-11-8(6)9/h2-4H,1H3,(H3,9,10,11)
InChI key:HWDZUCCQXHQYHS-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)C(=NN2)N
Found 4 products.