CymitQuimica logo

CAS 835621-11-9

:

2-Pyridinecarboxamide,4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-N-methyl-, 1-oxide

Description:
2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-N-methyl-, 1-oxide, identified by CAS number 835621-11-9, is a synthetic organic compound characterized by its complex molecular structure. It features a pyridine ring, which contributes to its aromatic properties, and multiple functional groups, including amide and ether linkages, which enhance its reactivity and solubility in various solvents. The presence of a trifluoromethyl group and a chloro substituent on the phenyl ring suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. The compound's 1-oxide designation indicates the presence of an oxidized nitrogen atom, which may influence its electronic properties and reactivity. Overall, this compound's intricate structure and functional diversity make it a subject of interest in medicinal chemistry and material science, where it may be explored for its potential therapeutic effects or as a building block in drug design.
Formula:C21H15ClF4N4O4
InChI:InChI=1S/C21H15ClF4N4O4/c1-27-19(31)18-10-13(6-7-30(18)33)34-12-3-5-17(16(23)9-12)29-20(32)28-11-2-4-15(22)14(8-11)21(24,25)26/h2-10H,1H3,(H,27,31)(H2,28,29,32)
InChI key:NUCXNEKIESREQY-UHFFFAOYSA-N
SMILES:CNC(=O)C1=[N+](C=CC(=C1)OC2=CC(=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F)F)[O-]
Found 13 products.