CymitQuimica logo

CAS 835627-45-7

:

6-Heptynoic acid, 2-amino-, (2S)-

Description:
6-Heptynoic acid, 2-amino-, (2S)-, with the CAS number 835627-45-7, is an amino acid derivative characterized by its alkyne functional group and a carboxylic acid moiety. This compound features a seven-carbon chain with a triple bond located at the sixth carbon, contributing to its unique reactivity and properties. The presence of an amino group at the second carbon position indicates that it is an α-amino acid, which is significant for its potential biological activity and role in peptide synthesis. The (2S) designation refers to the specific stereochemistry of the amino group, indicating that it has a particular spatial arrangement that can influence its interactions in biological systems. This compound may exhibit properties such as solubility in polar solvents, and its alkyne functionality can participate in various chemical reactions, including cycloadditions and cross-coupling reactions. Overall, 6-Heptynoic acid, 2-amino-, (2S)- is of interest in organic synthesis and potentially in pharmaceutical applications due to its structural features.
Formula:C7H11NO2
InChI:InChI=1S/C7H11NO2/c1-2-3-4-5-6(8)7(9)10/h1,6H,3-5,8H2,(H,9,10)/t6-/m0/s1
InChI key:IJQLLGJUHGAQIC-LURJTMIESA-N
SMILES:C#CCCC[C@@H](C(=O)O)N
Found 3 products.