CymitQuimica logo

CAS 83594-83-6

:

Benzene,1,3-difluoro-5-isocyanato-

Description:
Benzene, 1,3-difluoro-5-isocyanato- is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and an isocyanate group. The fluorine atoms are located at the 1 and 3 positions of the benzene ring, while the isocyanate group is situated at the 5 position. This compound is part of a class of chemicals known for their reactivity, particularly due to the isocyanate functional group, which can participate in various chemical reactions, including nucleophilic addition and polymerization. The presence of fluorine atoms can enhance the compound's stability and influence its physical properties, such as boiling and melting points. Additionally, the isocyanate group is known for its potential toxicity and reactivity, making safety precautions essential when handling this substance. Overall, Benzene, 1,3-difluoro-5-isocyanato- is significant in chemical synthesis and research, particularly in the development of polymers and other advanced materials.
Formula:C7H3F2NO
InChI:InChI=1S/C7H3F2NO/c8-5-1-6(9)3-7(2-5)10-4-11/h1-3H
InChI key:WUCCJYOIAJTFFQ-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1F)F)N=C=O
Synonyms:
  • 1,3-Difluoro-5-[isocyanato]benzene
  • 3,5-Difluoro-1-isocyanatobenzene
  • 3,5-Difluorophenyl isocyanate
Found 4 products.