CymitQuimica logo

CAS 83662-06-0

:

2-(2,5-dimethyl-1H-pyrrol-1-yl)ethanol

Description:
2-(2,5-Dimethyl-1H-pyrrol-1-yl)ethanol, with the CAS number 83662-06-0, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a hydroxyl (-OH) group attached to an ethyl chain, contributing to its classification as an alcohol. The presence of two methyl groups at the 2 and 5 positions of the pyrrole ring enhances its hydrophobic character while also influencing its reactivity and solubility in various solvents. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect its physical properties such as boiling point and solubility in polar solvents. Additionally, the compound's unique structure may lead to specific interactions with biological targets, warranting further investigation into its potential applications in drug development or as a chemical intermediate.
Formula:C8H13NO
InChI:InChI=1/C8H13NO/c1-7-3-4-8(2)9(7)5-6-10/h3-4,10H,5-6H2,1-2H3
InChI key:AREYOJNLKFSXPK-UHFFFAOYSA-N
SMILES:Cc1ccc(C)n1CCO
Synonyms:
  • 1H-pyrrole-1-ethanol, 2,5-dimethyl-
  • 2,5-Dimethyl-1H-pyrrole-1-ethanol
Found 2 products.