CymitQuimica logo

CAS 837430-20-3

:

1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-3-(2,2,2-trifluoroethyl)-

Description:
1,2,4-Triazolo[4,3-a]pyrazine, 5,6,7,8-tetrahydro-3-(2,2,2-trifluoroethyl)-, identified by CAS number 837430-20-3, is a heterocyclic compound featuring a fused triazole and pyrazine ring system. This compound exhibits a unique structural configuration that contributes to its potential biological activity. The presence of the trifluoroethyl group enhances its lipophilicity and may influence its interaction with biological targets. Typically, such compounds are of interest in medicinal chemistry due to their potential as pharmaceuticals or agrochemicals. The tetrahydro moiety suggests that it may possess certain conformational flexibility, which can be crucial for binding interactions. Additionally, the fluorinated substituent can improve metabolic stability and alter the compound's pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C7H9F3N4
InChI:InChI=1S/C7H9F3N4/c8-7(9,10)3-5-12-13-6-4-11-1-2-14(5)6/h11H,1-4H2
InChI key:UALWMRVSKAPXSF-UHFFFAOYSA-N
SMILES:C1CN2C(=NN=C2CC(F)(F)F)CN1
Found 5 products.