CAS 83747-30-2

3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid

Description:

3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid, identified by its CAS number 83747-30-2, is an organic compound characterized by its unique structure that includes an isoindole moiety and a propanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the carbonyl group in the isoindole structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the carboxylic acid group can engage in hydrogen bonding and may influence the compound's solubility in polar solvents. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. Overall, 3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid represents a versatile chemical entity with potential applications in various fields, including pharmaceuticals and organic synthesis.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c13-10(14)5-6-12-7-8-3-1-2-4-9(8)11(12)15/h1-4H,5-7H2,(H,13,14)

SMILES: c1ccc2c(c1)CN(CCC(=O)O)C2=O

Synonyms:

• 2H-isoindole-2-propanoic acid, 1,3-dihydro-1-oxo-

3-(1-Oxoisoindolin-2-yl)propanoic acid

CAS: 83747-30-2

Formula: C₁₁H₁₁NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 205.2099

Ref: IN-DA004X11

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid

CAS: 83747-30-2

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 205.21g/mol

Ref: 54-OR110885

3-(1-Oxo-1,3-dihydro-isoindol-2-yl)-propionic acid

CAS: 83747-30-2

Formula: C₁₁H₁₁NO₃

Purity: 95.0%

Color and Shape: No data available.

Molecular weight: 205.213

Ref: 10-F058480

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-propanoic acid

CAS: 83747-30-2

3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-propanoic acid is a ligand that has been shown to form square complexes with copper. It was found in x-ray structure analysis to bind to the axial position of the backbone of the protein and carboxylate groups coordinate with copper ions at the backbones. The coordination of copper ions and carboxylate groups are reversible. 3-(1-Oxo-1,3-dihydro-2H-isoindol-2-yl)-propanoic acid can be used as a bifunctional ligand for x-ray diffraction studies.

Formula: C₁₁H₁₁NO₃

Purity: Min. 95%

Molecular weight: 205.22 g/mol

Ref: 3D-IDA74730