CymitQuimica logo

CAS 83747-30-2

:

3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid

Description:
3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid, identified by its CAS number 83747-30-2, is an organic compound characterized by its unique structure that includes an isoindole moiety and a propanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and interactions. The presence of the carbonyl group in the isoindole structure suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Additionally, the carboxylic acid group can engage in hydrogen bonding and may influence the compound's solubility in polar solvents. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry and drug development. Overall, 3-(1-oxo-1,3-dihydro-2H-isoindol-2-yl)propanoic acid represents a versatile chemical entity with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C11H11NO3
InChI:InChI=1/C11H11NO3/c13-10(14)5-6-12-7-8-3-1-2-4-9(8)11(12)15/h1-4H,5-7H2,(H,13,14)
InChI key:QMNYVASLMSOSFP-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)CN(CCC(=O)O)C2=O
Synonyms:
  • 2H-isoindole-2-propanoic acid, 1,3-dihydro-1-oxo-
Found 4 products.