CymitQuimica logo

CAS 83864-70-4

:

AngeloylisogomisinO

Description:
Angeloylisogomisin O, with the CAS number 83864-70-4, is a chemical compound that belongs to the class of natural products, specifically a type of lignan. It is derived from various plant sources and is known for its potential biological activities. The compound typically exhibits characteristics such as a complex molecular structure, which may include multiple rings and functional groups that contribute to its reactivity and interaction with biological systems. Angeloylisogomisin O has been studied for its pharmacological properties, including antioxidant and anti-inflammatory effects, which may be attributed to its ability to modulate various biochemical pathways. Additionally, like many natural compounds, it may show variability in its activity depending on the specific conditions of its environment, such as pH and the presence of other substances. Research into this compound is ongoing, as scientists continue to explore its potential applications in medicine and pharmacology.
Formula:C28H34O8
InChI:InChI=1S/C28H34O8/c1-9-14(2)28(29)36-23-16(4)15(3)10-17-11-19(30-5)24(31-6)26(32-7)21(17)22-18(23)12-20-25(27(22)33-8)35-13-34-20/h9,11-12,15-16,23H,10,13H2,1-8H3/b14-9-/t15-,16-,23+/m0/s1
InChI key:PZUDCPSZWPLXKT-XXDSNBTQSA-N
SMILES:C/C=C(/C)\C(=O)O[C@@H]1[C@H]([C@H](CC2=CC(=C(C(=C2C3=C(C4=C(C=C13)OCO4)OC)OC)OC)OC)C)C
Found 6 products.