CymitQuimica logo

CAS 83881-08-7

:

Pregna-1,4-diene-3,20-dione,21-chloro-9,11-epoxy-17-hydroxy-16-methyl-, (9b,11b,16a)-

Description:
Pregna-1,4-diene-3,20-dione,21-chloro-9,11-epoxy-17-hydroxy-16-methyl-, commonly referred to by its CAS number 83881-08-7, is a synthetic steroid compound that exhibits characteristics typical of corticosteroids. This compound features a complex steroid structure, including a diene system and multiple functional groups such as a chloro substituent, an epoxy group, and a hydroxyl group. These structural elements contribute to its biological activity, particularly in modulating inflammatory responses and immune functions. The presence of the epoxy group suggests potential reactivity, which may influence its pharmacological properties. Additionally, the compound's stereochemistry, indicated by the specific configuration at various carbon centers, plays a crucial role in its interaction with biological targets, such as steroid receptors. Overall, this compound is of interest in medicinal chemistry and pharmacology, particularly for its potential therapeutic applications in treating conditions related to inflammation and immune dysregulation.
Formula:C22H27ClO4
InChI:InChI=1S/C22H27ClO4/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)22(15)18(27-22)10-20(16,3)21(12,26)17(25)11-23/h6-7,9,12,15-16,18,26H,4-5,8,10-11H2,1-3H3/t12-,15+,16+,18+,19+,20+,21+,22-/m1/s1
InChI key:QPODUJJKFOJKOZ-QDBZYVRYSA-N
SMILES:C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]35[C@@H](O5)C[C@@]2([C@]1(C(=O)CCl)O)C)C
Synonyms:
  • 21-Chloro-9-Beta,11-Beta-Epoxy-17-Hydroxy-16-Alpha-Methylpregna-1,4-Diene-3,20-Dione
Found 8 products.