CAS 83881-53-2
:{2-[4-(diphenylmethyl)piperazin-1-yl]ethoxy}acetic acid
Description:
{2-[4-(Diphenylmethyl)piperazin-1-yl]ethoxy}acetic acid, with the CAS number 83881-53-2, is a chemical compound characterized by its unique structure that includes a piperazine ring and a diphenylmethyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. It is likely to be soluble in organic solvents due to the presence of the hydrophobic diphenylmethyl moiety, while the carboxylic acid group may impart some degree of polarity, allowing for potential interactions with polar solvents. The piperazine ring can contribute to biological activity, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its potential applications may include acting as a ligand in drug design or serving as a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure routes.
Formula:C21H26N2O3
InChI:InChI=1/C21H26N2O3/c24-20(25)17-26-16-15-22-11-13-23(14-12-22)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,21H,11-17H2,(H,24,25)
SMILES:c1ccc(cc1)C(c1ccccc1)N1CCN(CC1)CCOCC(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Deschloro Cetirizine (2-{2-[4-(Diphenylmethyl)piperazin-1-yl]ethoxy}acetic acid)
CAS:Compounds containing a pyrimidine ring, whether or not hydrogenated, or piperazine ring in the structure, nesoiFormula:C21H26N2O3Color and Shape:Beige Crystalline PowderMolecular weight:354.194342-(2-(4-Benzhydrylpiperazin-1-yl)ethoxy)acetic acid
CAS:2-(2-(4-Benzhydrylpiperazin-1-yl)ethoxy)acetic acidPurity:98%Molecular weight:354.45g/molCetirizine EP Impurity F
CAS:Formula:C21H26N2O3Color and Shape:White To Off-White SolidMolecular weight:354.454’-Deschloro Cetirizine
CAS:Controlled ProductFormula:C21H26N2O3Color and Shape:NeatMolecular weight:354.443Cetirizine impurity F
CAS:Cetirizine impurity F is a potential impurity of cetirizine and ranitidine. It has been shown to be present in the final drug substance and has been found to have the same profile as cetirizine. Cetirizine impurity F can be synthesized from metformin, which is an active ingredient in diabetes treatment. This agent belongs to the group of medicines called antihistamines that are used for relieving allergy symptoms such as runny nose, sneezing, itchy eyes, and itchy throat. Cetirizine impurity F is a member of the drug class called H1-antihistamines that competitively binds to histamine receptors on cells responsible for allergic reactions.Formula:C21H26N2O3Purity:Min. 95%Molecular weight:354.44 g/mol






