CymitQuimica logo

CAS 83881-53-2

:

{2-[4-(diphenylmethyl)piperazin-1-yl]ethoxy}acetic acid

Description:
{2-[4-(Diphenylmethyl)piperazin-1-yl]ethoxy}acetic acid, with the CAS number 83881-53-2, is a chemical compound characterized by its unique structure that includes a piperazine ring and a diphenylmethyl group. This compound typically exhibits properties associated with both amines and carboxylic acids, which may influence its solubility and reactivity. It is likely to be soluble in organic solvents due to the presence of the hydrophobic diphenylmethyl moiety, while the carboxylic acid group may impart some degree of polarity, allowing for potential interactions with polar solvents. The piperazine ring can contribute to biological activity, making this compound of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its potential applications may include acting as a ligand in drug design or serving as a building block for more complex molecules. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure routes.
Formula:C21H26N2O3
InChI:InChI=1/C21H26N2O3/c24-20(25)17-26-16-15-22-11-13-23(14-12-22)21(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-10,21H,11-17H2,(H,24,25)
InChI key:PCSREFRBRMMIHJ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c1ccccc1)N1CCN(CC1)CCOCC(=O)O
Found 9 products.