CymitQuimica logo

CAS 838845-52-6

:

1-Piperazinecarboxylic acid, 4-(3-iodobenzoyl)-, 1,1-dimethylethyl ester

Description:
1-Piperazinecarboxylic acid, 4-(3-iodobenzoyl)-, 1,1-dimethylethyl ester, identified by its CAS number 838845-52-6, is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxylic acid moiety that is esterified with a tert-butyl group, enhancing its lipophilicity and stability. The presence of a 3-iodobenzoyl group introduces significant molecular complexity and may influence its biological activity and reactivity. Typically, compounds of this nature are studied for their potential pharmaceutical applications, particularly in drug design, due to their ability to interact with biological targets. The iodine substituent can also play a role in enhancing the compound's properties, such as its binding affinity or metabolic stability. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, with potential implications in therapeutic development.
Formula:C16H21IN2O3
InChI:InChI=1S/C16H21IN2O3/c1-16(2,3)22-15(21)19-9-7-18(8-10-19)14(20)12-5-4-6-13(17)11-12/h4-6,11H,7-10H2,1-3H3
InChI key:DYWUNSKOZOZBCR-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCN(CC1)C(=O)C2=CC(=CC=C2)I
Found 2 products.