CymitQuimica logo

CAS 838892-95-8

:

Thiazole, 5-(bromomethyl)-2-methyl-

Description:
Thiazole, 5-(bromomethyl)-2-methyl- is a heterocyclic organic compound characterized by the presence of a thiazole ring, which consists of a five-membered ring containing both sulfur and nitrogen atoms. The specific structure includes a bromomethyl group at the 5-position and a methyl group at the 2-position of the thiazole ring. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its bromomethyl substituent can participate in nucleophilic substitution reactions, making it a versatile building block in organic synthesis. The presence of the thiazole moiety often imparts biological activity, and compounds containing thiazole rings are known for their diverse pharmacological properties. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact. Overall, Thiazole, 5-(bromomethyl)-2-methyl- is a significant compound in the field of organic chemistry with potential applications in medicinal chemistry and material science.
Formula:C5H6BrNS
InChI:InChI=1S/C5H6BrNS/c1-4-7-3-5(2-6)8-4/h3H,2H2,1H3
InChI key:WKOAATBPJLXWLP-UHFFFAOYSA-N
SMILES:CC1=NC=C(S1)CBr
Found 5 products.