CAS 83920-64-3

2H-Pyran-2-one,5,6-dihydro-4-methoxy-(9CI)

Description:

2H-Pyran-2-one, 5,6-dihydro-4-methoxy- (CAS 83920-64-3) is an organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound exhibits a methoxy group (-OCH3) at the 4-position, contributing to its chemical reactivity and potential applications in organic synthesis. The presence of the dihydro group indicates that the compound has two additional hydrogen atoms, which can influence its stability and reactivity compared to fully unsaturated analogs. 2H-Pyran-2-one derivatives are often studied for their biological activities, including potential antimicrobial and anti-inflammatory properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents makes it useful in various chemical reactions and formulations. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.

Formula: C₆H₈O₃

InChI: InChI=1S/C6H8O3/c1-8-5-2-3-9-6(7)4-5/h4H,2-3H2,1H3

InChI key: MEZHTUKDGVTUCD-UHFFFAOYSA-N

SMILES: COC1=CC(=O)OCC1

Synonyms:

• 5,6-Dihydro-4-methoxy-2H-pyran-2-one
• 2H-Pyran-2-one,5,6-dihydro-4-methoxy-(9CI)

5,6-Dihydro-4-methoxy-2H-pyran-2-one

CAS: 83920-64-3

5,6-Dihydro-4-methoxy-2H-pyran-2-one is produced by the Penicillium italicum strain MRC 1360.

Formula: C₆H₈O₃

Color and Shape: Solid

Molecular weight: 128.13

Ref: TM-TN10788