CymitQuimica logo

CAS 83921-07-7

:

8-Hydroxyhexadecanoic acid

Description:
8-Hydroxyhexadecanoic acid, also known as 8-hydroxy palmitic acid, is a fatty acid characterized by a hydroxyl group (-OH) located at the eighth carbon of the hexadecanoic acid chain. This compound typically appears as a white to off-white solid or waxy substance. It is soluble in organic solvents but has limited solubility in water due to its long hydrophobic carbon chain. The presence of the hydroxyl group imparts unique properties, such as increased polarity and potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. 8-Hydroxyhexadecanoic acid is of interest in various fields, including biochemistry and materials science, due to its potential applications in surfactants, emulsifiers, and as a building block for more complex molecules. Additionally, it may exhibit biological activity, making it relevant in pharmaceutical research. As with many fatty acids, its behavior can be influenced by factors such as temperature and pH, which are important to consider in practical applications.
Formula:C16H32O3
InChI:InChI=1S/C16H32O3/c1-2-3-4-5-6-9-12-15(17)13-10-7-8-11-14-16(18)19/h15,17H,2-14H2,1H3,(H,18,19)
InChI key:InChIKey=KMEKMXBMYZGGDT-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(CCCCCCCC)O
Synonyms:
  • 8-Hydroxypalmitic acid
  • Hexadecanoic acid, 8-hydroxy-
  • 8-Hydroxyhexadecanoic acid
Found 2 products.