CAS 83922-54-7
:N-(4-formylphenyl)methanesulfonamide
Description:
N-(4-formylphenyl)methanesulfonamide, with the CAS number 83922-54-7, is an organic compound characterized by the presence of a sulfonamide functional group attached to a phenyl ring that carries a formyl substituent. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents due to the sulfonamide group, which enhances its ability to interact with water. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and nucleophilic addition. Its sulfonamide moiety may impart biological activity, making it of interest in medicinal chemistry. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, its reactivity and functional groups allow for further derivatization, which can lead to the synthesis of more complex molecules. Overall, N-(4-formylphenyl)methanesulfonamide is a versatile compound with potential utility in both research and application in various chemical fields.
Formula:C8H9NO3S
InChI:InChI=1/C8H9NO3S/c1-13(11,12)9-8-4-2-7(6-10)3-5-8/h2-6,9H,1H3
SMILES:CS(=O)(=O)Nc1ccc(cc1)C=O
Synonyms:- Methanesulfonamide, N-(4-formylphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Sotalol Related Compound B (N-(4-Formylphenyl)methanesulfonamide)
CAS:Sulfonamides, nesoiFormula:C8H9NO3SColor and Shape:Yellow Crystalline PowderMolecular weight:199.03031Sotalol Related Compound B
CAS:4-(Methylsulfonamido)benzaldehydeFormula:C8H9NO3SPurity:98%Molecular weight:199.234-(Methylsulfonamido)benzaldehyde
CAS:4-(Methylsulfonamido)benzaldehydeFormula:C8H9NO3SPurity:98%Color and Shape:SolidMolecular weight:199.226964-(Methylsulfonamido)benzaldehyde
CAS:Formula:C8H9NO3SPurity:97%Color and Shape:SolidMolecular weight:199.2270N-(4-Formylphenyl)methanesulphonamide
CAS:Controlled ProductFormula:C8H9NO3SColor and Shape:NeatMolecular weight:199.23N-(4-Formylphenyl)methanesulfonamide
CAS:Formula:C8H9NO3SPurity:97%Color and Shape:SolidMolecular weight:199.22N-(4-Formylphenyl)methanesulfonamide
CAS:Controlled ProductApplications N-(4-Formylphenyl)methanesulfonamide is a related compound to Sotalol (S677300), a class III antiarrythmic. It is also used in the preparation of pharmaceutical compounds such as triple monoamine reuptake inhibitors (antidepressants) and lactate dehydrogenase inhibitors (anticancer) medications.This compound is suitable for lactate dehydrogenase (LDH) related research.
References Uloth, et al.: J. Med. Chem., 9, 88 (1966), Groh, W.J., et al.: Chirality, 5, 8 (1993); Ward, R. et al.: J. Med. Chem., 55, 3285 (2012); Santra, S. et al.: Bioorg. Med. Chem. Lett., 22, 5317 (2012);Formula:C8H9NO3SColor and Shape:NeatMolecular weight:199.23








