CymitQuimica logo

CAS 83945-57-7

:

4-Epicommunic acid

Description:
4-Epicommunic acid, with the CAS number 83945-57-7, is a naturally occurring organic compound classified as a phenolic acid. It is derived from various plant sources and is known for its potential biological activities, including antioxidant and anti-inflammatory properties. The structure of 4-epicommunic acid features a carboxylic acid functional group and a phenolic hydroxyl group, which contribute to its reactivity and interaction with biological systems. This compound is often studied for its role in plant metabolism and its potential health benefits in human nutrition. Additionally, it may exhibit antimicrobial properties, making it of interest in food preservation and pharmacological applications. As with many phenolic compounds, its solubility in water is limited, but it can dissolve in organic solvents, which influences its extraction and utilization in various applications. Overall, 4-epicommunic acid represents a significant area of research in natural products chemistry and its implications for health and disease management.
Formula:C20H30O2
InChI:InChI=1S/C20H30O2/c1-6-14(2)8-10-16-15(3)9-11-17-19(16,4)12-7-13-20(17,5)18(21)22/h6,8,16-17H,1,3,7,9-13H2,2,4-5H3,(H,21,22)/b14-8+/t16-,17+,19+,20+/m0/s1
InChI key:YGBZFOQXPOGACY-ONIUZDBUSA-N
SMILES:C/C(=C\C[C@H]1C(=C)CC[C@@H]2[C@@]1(CCC[C@@]2(C)C(=O)O)C)/C=C
Found 4 products.