CymitQuimica logo

CAS 839712-09-3

:

1H-1,4-Diazepine, 1-(2,3-dichlorophenyl)hexahydro-,monohydrochloride

Description:
1H-1,4-Diazepine, 1-(2,3-dichlorophenyl)hexahydro-, monohydrochloride is a chemical compound characterized by its diazepine structure, which consists of a seven-membered ring containing two nitrogen atoms. This compound features a hexahydro configuration, indicating that it is saturated and contains no double bonds within the ring. The presence of a 2,3-dichlorophenyl group suggests that it has significant hydrophobic characteristics due to the chlorinated aromatic system, which can influence its biological activity and solubility. As a monohydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its potential for pharmaceutical applications. The compound may exhibit various biological activities, potentially including anxiolytic or sedative effects, typical of many diazepine derivatives. However, specific pharmacological properties would require further investigation through empirical studies. Safety and handling precautions should be observed due to the presence of chlorine substituents, which can impart toxicity.
Formula:C11H14Cl2N2・ClH
InChI:InChI=1S/C11H14Cl2N2.ClH/c12-9-3-1-4-10(11(9)13)15-7-2-5-14-6-8-15;/h1,3-4,14H,2,5-8H2;1H
InChI key:UCHZHYQSYVASBA-UHFFFAOYSA-N
SMILES:C1CNCCN(C1)C2=C(C(=CC=C2)Cl)Cl.Cl
Found 1 products.