CAS 839720-60-4

5-methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid

Description:

5-Methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid is a boron-containing organic compound characterized by its unique dioxaborinane structure, which includes a five-membered ring containing boron and oxygen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of both a methyl group and a phenyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. The boron atom in the dioxaborinane ring can participate in coordination chemistry, making this compound of interest in the development of boron-based reagents and catalysts. Its structural features may also impart specific biological activities, making it a candidate for further research in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the aromatic ring and the overall molecular conformation. Overall, 5-methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid represents a versatile structure with potential applications in organic synthesis and materials science.

Formula: C₁₁H₁₃BO₄

InChI: InChI=1/C11H13BO4/c1-11(10(13)14)7-15-12(16-8-11)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,13,14)

InChI key: QOBHKTQNPVOMIX-UHFFFAOYSA-N

SMILES: CC1(COB(c2ccccc2)OC1)C(=O)O

Synonyms:

• 1,3,2-Dioxaborinane-5-Carboxylic Acid, 5-Methyl-2-Phenyl-
• 5-Methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid

5-Methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid

CAS: 839720-60-4

5-Methyl-2-phenyl-1,3,2-dioxaborinane-5-carboxylic acid

Molecular weight: 220.0299988

Ref: 10-F922510