CAS 84000-73-7

1,12-Diheptyl 2,5,8,11-tetraoxadodecanedioate

Description:

1,12-Diheptyl 2,5,8,11-tetraoxadodecanedioate is a synthetic compound characterized by its long hydrocarbon chain and multiple ether linkages. This substance features a dodecanedioate backbone, which contributes to its potential applications in polymer chemistry and materials science. The presence of heptyl groups enhances its hydrophobic properties, making it suitable for use in various formulations, including surfactants and emulsifiers. The tetraoxadodecanedioate structure indicates that it contains four ether (–O–) linkages, which can influence its solubility and reactivity. This compound may exhibit interesting thermal and mechanical properties due to its unique molecular architecture. Additionally, its potential applications could extend to fields such as drug delivery systems, where biocompatibility and stability are essential. As with many synthetic compounds, safety and handling precautions should be observed, and its environmental impact should be assessed in any practical applications. Overall, 1,12-Diheptyl 2,5,8,11-tetraoxadodecanedioate represents a versatile chemical with promising characteristics for various industrial and research applications.

Formula: C₂₂H₄₂O₈

InChI: InChI=1S/C22H42O8/c1-3-5-7-9-11-13-27-21(23)29-19-17-25-15-16-26-18-20-30-22(24)28-14-12-10-8-6-4-2/h3-20H2,1-2H3

InChI key: InChIKey=KQZRBBXZAHUJHP-UHFFFAOYSA-N

SMILES: O(C(OCCCCCCC)=O)CCOCCOCCOC(OCCCCCCC)=O

Synonyms:

• 2,5,8,11-Tetraoxadodecanedioic acid, diheptyl ester
• 2,5,8,11-Tetraoxadodecanedioic acid, 1,12-diheptyl ester
• 1,12-Diheptyl 2,5,8,11-tetraoxadodecanedioate

2,5,8,11-Tetraoxadodecanedioicacid, 1,12-diheptyl ester

CAS: 84000-73-7

Formula: C₂₂H₄₂O₈

Molecular weight: 434.5641

Ref: IN-DA004QIK